C19H20IN3O4S2 — CID 126032277
2-(4-iodo-N-methylsulfonylanilino)-N-[(Z)-[3-(thietan-3-yloxy)phenyl]methylideneamino]acetamide (PubChem CID 126032277) has the molecular formula C19H20IN3O4S2 and a molecular weight of 545.42 g/mol. Its IUPAC name is 2-(4-iodo-N-methylsulfonylanilino)-N-[(Z)-[3-(thietan-3-yloxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-iodo-N-methylsulfonylanilino)-N-[(Z)-[3-(thietan-3-yloxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126032277 |
| Molecular Formula | C19H20IN3O4S2 |
| Molecular Weight | 545.42 g/mol |
| Exact Mass | 544.99 |
| IUPAC Name | 2-(4-iodo-N-methylsulfonylanilino)-N-[(Z)-[3-(thietan-3-yloxy)phenyl]methylideneamino]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)N/N=C\c1cccc(OC2CSC2)c1)c1ccc(I)cc1 |
| InChI | InChI=1S/C19H20IN3O4S2/c1-29(25,26)23(16-7-5-15(20)6-8-16)11-19(24)22-21-10-14-3-2-4-17(9-14)27-18-12-28-13-18/h2-10,18H,11-13H2,1H3,(H,22,24)/b21-10- |
| InChIKey | YXFPQJBDBQIQRO-FBHDLOMBSA-N |
| XLogP | 2.70 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|