C17H18IN3O3S2 — CID 126033644
2-(4-iodo-N-methylsulfonylanilino)-N-[(Z)-(4-methylsulfanylphenyl)methylideneamino]acetamide (PubChem CID 126033644) has the molecular formula C17H18IN3O3S2 and a molecular weight of 503.39 g/mol. Its IUPAC name is 2-(4-iodo-N-methylsulfonylanilino)-N-[(Z)-(4-methylsulfanylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-iodo-N-methylsulfonylanilino)-N-[(Z)-(4-methylsulfanylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126033644 |
| Molecular Formula | C17H18IN3O3S2 |
| Molecular Weight | 503.39 g/mol |
| Exact Mass | 502.98 |
| IUPAC Name | 2-(4-iodo-N-methylsulfonylanilino)-N-[(Z)-(4-methylsulfanylphenyl)methylideneamino]acetamide |
| SMILES | CSc1ccc(/C=N\NC(=O)CN(c2ccc(I)cc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H18IN3O3S2/c1-25-16-9-3-13(4-10-16)11-19-20-17(22)12-21(26(2,23)24)15-7-5-14(18)6-8-15/h3-11H,12H2,1-2H3,(H,20,22)/b19-11- |
| InChIKey | BFBONSCPOKVQGP-ODLFYWEKSA-N |
| XLogP | 2.93 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|