C26H28N6O6S2 — CID 16761126
2-(N-methylsulfonylanilino)-N-[(E)-[4-[(E)-[[2-(N-methylsulfonylanilino)acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide (PubChem CID 16761126) has the molecular formula C26H28N6O6S2 and a molecular weight of 584.68 g/mol. Its IUPAC name is 2-(N-methylsulfonylanilino)-N-[(E)-[4-[(E)-[[2-(N-methylsulfonylanilino)acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(N-methylsulfonylanilino)-N-[(E)-[4-[(E)-[[2-(N-methylsulfonylanilino)acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 16761126 |
| Molecular Formula | C26H28N6O6S2 |
| Molecular Weight | 584.68 g/mol |
| Exact Mass | 584.15 |
| IUPAC Name | 2-(N-methylsulfonylanilino)-N-[(E)-[4-[(E)-[[2-(N-methylsulfonylanilino)acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)N/N=C/c1ccc(/C=N/NC(=O)CN(c2ccccc2)S(C)(=O)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H28N6O6S2/c1-39(35,36)31(23-9-5-3-6-10-23)19-25(33)29-27-17-21-13-15-22(16-14-21)18-28-30-26(34)20-32(40(2,37)38)24-11-7-4-8-12-24/h3-18H,19-20H2,1-2H3,(H,29,33)(H,30,34)/b27-17+,28-18+ |
| InChIKey | HKJGTZMEYNMEPG-XUIWWLCJSA-N |
| XLogP | 1.52 |
| TPSA | 157.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.68 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|