C17H18BrN3O3S — CID 28589140
2-(3-bromo-N-methylsulfonylanilino)-N-[(Z)-(4-methylphenyl)methylideneamino]acetamide (PubChem CID 28589140) has the molecular formula C17H18BrN3O3S and a molecular weight of 424.32 g/mol. Its IUPAC name is 2-(3-bromo-N-methylsulfonylanilino)-N-[(Z)-(4-methylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(3-bromo-N-methylsulfonylanilino)-N-[(Z)-(4-methylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 28589140 |
| Molecular Formula | C17H18BrN3O3S |
| Molecular Weight | 424.32 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | 2-(3-bromo-N-methylsulfonylanilino)-N-[(Z)-(4-methylphenyl)methylideneamino]acetamide |
| SMILES | Cc1ccc(/C=N\NC(=O)CN(c2cccc(Br)c2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H18BrN3O3S/c1-13-6-8-14(9-7-13)11-19-20-17(22)12-21(25(2,23)24)16-5-3-4-15(18)10-16/h3-11H,12H2,1-2H3,(H,20,22)/b19-11- |
| InChIKey | ZTXAWSKZFKAMFW-ODLFYWEKSA-N |
| XLogP | 2.67 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|