C33H34N6O4S — CID 98087091
2-[benzenesulfonyl-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-N-[(Z)-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylideneamino]acetamide (PubChem CID 98087091) has the molecular formula C33H34N6O4S and a molecular weight of 610.74 g/mol. Its IUPAC name is 2-[benzenesulfonyl-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-N-[(Z)-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-[benzenesulfonyl-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-N-[(Z)-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 98087091 |
| Molecular Formula | C33H34N6O4S |
| Molecular Weight | 610.74 g/mol |
| Exact Mass | 610.24 |
| IUPAC Name | 2-[benzenesulfonyl-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-N-[(Z)-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylideneamino]acetamide |
| SMILES | Cc1cccc(-n2c(C)cc(/C=N\NC(=O)CN(c3c(C)n(C)n(-c4ccccc4)c3=O)S(=O)(=O)c3ccccc3)c2C)c1 |
| InChI | InChI=1S/C33H34N6O4S/c1-23-13-12-16-29(19-23)38-24(2)20-27(25(38)3)21-34-35-31(40)22-37(44(42,43)30-17-10-7-11-18-30)32-26(4)36(5)39(33(32)41)28-14-8-6-9-15-28/h6-21H,22H2,1-5H3,(H,35,40)/b34-21- |
| InChIKey | NUNMZRACLHSQRK-ZXSNDDASSA-N |
| XLogP | 4.55 |
| TPSA | 110.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.74 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|