C27H24ClN3O4S — CID 137107508
2-(5-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide (PubChem CID 137107508) has the molecular formula C27H24ClN3O4S and a molecular weight of 522.03 g/mol. Its IUPAC name is 2-(5-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide.
| Compound Name | 2-(5-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 137107508 |
| Molecular Formula | C27H24ClN3O4S |
| Molecular Weight | 522.03 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | 2-(5-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)N/N=C\c2c(O)ccc3ccccc23)c2cc(Cl)ccc2C)cc1 |
| InChI | InChI=1S/C27H24ClN3O4S/c1-18-7-12-22(13-8-18)36(34,35)31(25-15-21(28)11-9-19(25)2)17-27(33)30-29-16-24-23-6-4-3-5-20(23)10-14-26(24)32/h3-16,32H,17H2,1-2H3,(H,30,33)/b29-16- |
| InChIKey | VOBMMFUXTKOEQQ-MWLSYYOVSA-N |
| XLogP | 5.16 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.03 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|