C27H25N3O5S — CID 136719029
2-[N-(benzenesulfonyl)-2-methoxy-5-methylanilino]-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide (PubChem CID 136719029) has the molecular formula C27H25N3O5S and a molecular weight of 503.58 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-methoxy-5-methylanilino]-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-methoxy-5-methylanilino]-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 136719029 |
| Molecular Formula | C27H25N3O5S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-methoxy-5-methylanilino]-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide |
| SMILES | COc1ccc(C)cc1N(CC(=O)N/N=C\c1c(O)ccc2ccccc12)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H25N3O5S/c1-19-12-15-26(35-2)24(16-19)30(36(33,34)21-9-4-3-5-10-21)18-27(32)29-28-17-23-22-11-7-6-8-20(22)13-14-25(23)31/h3-17,31H,18H2,1-2H3,(H,29,32)/b28-17- |
| InChIKey | WODPANVVMAVRJR-QRQIAZFYSA-N |
| XLogP | 4.21 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|