C26H27N3O7S — CID 43876827
methyl 2-[3-[(E)-[[2-[N-(benzenesulfonyl)-2-methoxy-5-methylanilino]acetyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 43876827) has the molecular formula C26H27N3O7S and a molecular weight of 525.58 g/mol. Its IUPAC name is methyl 2-[3-[(E)-[[2-[N-(benzenesulfonyl)-2-methoxy-5-methylanilino]acetyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[3-[(E)-[[2-[N-(benzenesulfonyl)-2-methoxy-5-methylanilino]acetyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 43876827 |
| Molecular Formula | C26H27N3O7S |
| Molecular Weight | 525.58 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | methyl 2-[3-[(E)-[[2-[N-(benzenesulfonyl)-2-methoxy-5-methylanilino]acetyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1cccc(/C=N/NC(=O)CN(c2cc(C)ccc2OC)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C26H27N3O7S/c1-19-12-13-24(34-2)23(14-19)29(37(32,33)22-10-5-4-6-11-22)17-25(30)28-27-16-20-8-7-9-21(15-20)36-18-26(31)35-3/h4-16H,17-18H2,1-3H3,(H,28,30)/b27-16+ |
| InChIKey | LXJURVPBQCEQJW-JVWAILMASA-N |
| XLogP | 2.90 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.58 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|