C25H24ClN3O6S — CID 124544385
methyl 2-[3-[(Z)-[[2-[N-(benzenesulfonyl)-3-chloro-4-methylanilino]acetyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 124544385) has the molecular formula C25H24ClN3O6S and a molecular weight of 530.00 g/mol. Its IUPAC name is methyl 2-[3-[(Z)-[[2-[N-(benzenesulfonyl)-3-chloro-4-methylanilino]acetyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[3-[(Z)-[[2-[N-(benzenesulfonyl)-3-chloro-4-methylanilino]acetyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 124544385 |
| Molecular Formula | C25H24ClN3O6S |
| Molecular Weight | 530.00 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | methyl 2-[3-[(Z)-[[2-[N-(benzenesulfonyl)-3-chloro-4-methylanilino]acetyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1cccc(/C=N\NC(=O)CN(c2ccc(C)c(Cl)c2)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C25H24ClN3O6S/c1-18-11-12-20(14-23(18)26)29(36(32,33)22-9-4-3-5-10-22)16-24(30)28-27-15-19-7-6-8-21(13-19)35-17-25(31)34-2/h3-15H,16-17H2,1-2H3,(H,28,30)/b27-15- |
| InChIKey | HSPUWRLGIUGXTC-DICXZTSXSA-N |
| XLogP | 3.55 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.00 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|