C29H27N3O5S — CID 3108667
2-[N-(benzenesulfonyl)-4-ethoxyanilino]-N-[(3-phenoxyphenyl)methylideneamino]acetamide (PubChem CID 3108667) has the molecular formula C29H27N3O5S and a molecular weight of 529.62 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-ethoxyanilino]-N-[(3-phenoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-ethoxyanilino]-N-[(3-phenoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3108667 |
| Molecular Formula | C29H27N3O5S |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-ethoxyanilino]-N-[(3-phenoxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1ccc(N(CC(=O)NN=Cc2cccc(Oc3ccccc3)c2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H27N3O5S/c1-2-36-25-18-16-24(17-19-25)32(38(34,35)28-14-7-4-8-15-28)22-29(33)31-30-21-23-10-9-13-27(20-23)37-26-11-5-3-6-12-26/h3-21H,2,22H2,1H3,(H,31,33) |
| InChIKey | BCGHVGLRCKRUER-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|