C23H21Cl2N3O3S — CID 92644372
2-(3,5-dichloro-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-(3-methylphenyl)methylideneamino]acetamide (PubChem CID 92644372) has the molecular formula C23H21Cl2N3O3S and a molecular weight of 490.41 g/mol. Its IUPAC name is 2-(3,5-dichloro-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-(3-methylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(3,5-dichloro-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-(3-methylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 92644372 |
| Molecular Formula | C23H21Cl2N3O3S |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | 2-(3,5-dichloro-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-(3-methylphenyl)methylideneamino]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)N/N=C\c2cccc(C)c2)c2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C23H21Cl2N3O3S/c1-16-6-8-22(9-7-16)32(30,31)28(21-12-19(24)11-20(25)13-21)15-23(29)27-26-14-18-5-3-4-17(2)10-18/h3-14H,15H2,1-2H3,(H,27,29)/b26-14- |
| InChIKey | LJQZRDSGIJWDNS-WGARJPEWSA-N |
| XLogP | 4.96 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|