C26H20Cl2FN3O4S — CID 5020035
N-[[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-(4-fluoro-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 5020035) has the molecular formula C26H20Cl2FN3O4S and a molecular weight of 560.43 g/mol. Its IUPAC name is N-[[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-(4-fluoro-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-(4-fluoro-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 5020035 |
| Molecular Formula | C26H20Cl2FN3O4S |
| Molecular Weight | 560.43 g/mol |
| Exact Mass | 559.05 |
| IUPAC Name | N-[[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-(4-fluoro-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NN=Cc2ccc(-c3ccc(Cl)cc3Cl)o2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H20Cl2FN3O4S/c1-17-2-10-22(11-3-17)37(34,35)32(20-7-5-19(29)6-8-20)16-26(33)31-30-15-21-9-13-25(36-21)23-12-4-18(27)14-24(23)28/h2-15H,16H2,1H3,(H,31,33) |
| InChIKey | FIYLIRJEVHCIKU-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.43 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|