C21H20BrN3O4S — CID 94838500
2-[N-(benzenesulfonyl)-4-methylanilino]-N-[(Z)-(4-bromo-5-methylfuran-2-yl)methylideneamino]acetamide (PubChem CID 94838500) has the molecular formula C21H20BrN3O4S and a molecular weight of 490.38 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-methylanilino]-N-[(Z)-(4-bromo-5-methylfuran-2-yl)methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-methylanilino]-N-[(Z)-(4-bromo-5-methylfuran-2-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 94838500 |
| Molecular Formula | C21H20BrN3O4S |
| Molecular Weight | 490.38 g/mol |
| Exact Mass | 489.04 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-methylanilino]-N-[(Z)-(4-bromo-5-methylfuran-2-yl)methylideneamino]acetamide |
| SMILES | Cc1ccc(N(CC(=O)N/N=C\c2cc(Br)c(C)o2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20BrN3O4S/c1-15-8-10-17(11-9-15)25(30(27,28)19-6-4-3-5-7-19)14-21(26)24-23-13-18-12-20(22)16(2)29-18/h3-13H,14H2,1-2H3,(H,24,26)/b23-13- |
| InChIKey | WDUDHEIRADTLCP-QRVIBDJDSA-N |
| XLogP | 4.00 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|