C30H27ClFN3O6S — CID 126145296
N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetamide (PubChem CID 126145296) has the molecular formula C30H27ClFN3O6S and a molecular weight of 612.08 g/mol. Its IUPAC name is N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetamide.
| Compound Name | N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetamide |
|---|---|
| PubChem CID | 126145296 |
| Molecular Formula | C30H27ClFN3O6S |
| Molecular Weight | 612.08 g/mol |
| Exact Mass | 611.13 |
| IUPAC Name | N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)N/N=C\c2ccc(OCc3ccc(Cl)cc3)cc2)c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C30H27ClFN3O6S/c1-39-28-16-15-27(17-29(28)40-2)42(37,38)35(25-11-9-24(32)10-12-25)19-30(36)34-33-18-21-5-13-26(14-6-21)41-20-22-3-7-23(31)8-4-22/h3-18H,19-20H2,1-2H3,(H,34,36)/b33-18- |
| InChIKey | LDMKUENFWWMIFV-OHUYPAJKSA-N |
| XLogP | 5.42 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.08 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|