C25H25ClN4O8S — CID 126033558
N-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide (PubChem CID 126033558) has the molecular formula C25H25ClN4O8S and a molecular weight of 577.02 g/mol. Its IUPAC name is N-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide.
| Compound Name | N-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide |
|---|---|
| PubChem CID | 126033558 |
| Molecular Formula | C25H25ClN4O8S |
| Molecular Weight | 577.02 g/mol |
| Exact Mass | 576.11 |
| IUPAC Name | N-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide |
| SMILES | CCOc1ccc(N(CC(=O)N/N=C\c2cc([N+](=O)[O-])ccc2Cl)S(=O)(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C25H25ClN4O8S/c1-4-38-20-8-5-18(6-9-20)29(39(34,35)21-10-12-23(36-2)24(14-21)37-3)16-25(31)28-27-15-17-13-19(30(32)33)7-11-22(17)26/h5-15H,4,16H2,1-3H3,(H,28,31)/b27-15- |
| InChIKey | XKJWRKSUDVBXTC-DICXZTSXSA-N |
| XLogP | 4.01 |
| TPSA | 149.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.02 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|