C33H33ClN4O8S — CID 126034757
N-[(Z)-[4-[2-(3-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide (PubChem CID 126034757) has the molecular formula C33H33ClN4O8S and a molecular weight of 681.17 g/mol. Its IUPAC name is N-[(Z)-[4-[2-(3-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide.
| Compound Name | N-[(Z)-[4-[2-(3-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide |
|---|---|
| PubChem CID | 126034757 |
| Molecular Formula | C33H33ClN4O8S |
| Molecular Weight | 681.17 g/mol |
| Exact Mass | 680.17 |
| IUPAC Name | N-[(Z)-[4-[2-(3-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide |
| SMILES | CCOc1ccc(N(CC(=O)N/N=C\c2ccc(OCC(=O)Nc3cccc(Cl)c3)cc2)S(=O)(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C33H33ClN4O8S/c1-4-45-27-14-10-26(11-15-27)38(47(41,42)29-16-17-30(43-2)31(19-29)44-3)21-32(39)37-35-20-23-8-12-28(13-9-23)46-22-33(40)36-25-7-5-6-24(34)18-25/h5-20H,4,21-22H2,1-3H3,(H,36,40)(H,37,39)/b35-20- |
| InChIKey | LYGMAECOADXNKE-OJYCWLPVSA-N |
| XLogP | 5.12 |
| TPSA | 144.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.17 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|