C32H31FN4O7S — CID 3943872
2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)-N-[[4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide (PubChem CID 3943872) has the molecular formula C32H31FN4O7S and a molecular weight of 634.69 g/mol. Its IUPAC name is 2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)-N-[[4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)-N-[[4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 3943872 |
| Molecular Formula | C32H31FN4O7S |
| Molecular Weight | 634.69 g/mol |
| Exact Mass | 634.19 |
| IUPAC Name | 2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)-N-[[4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide |
| SMILES | COc1ccc(N(CC(=O)NN=Cc2ccc(OCC(=O)Nc3ccc(F)cc3)cc2)S(=O)(=O)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C32H31FN4O7S/c1-22-4-15-28(16-5-22)45(40,41)37(26-12-17-29(42-2)30(18-26)43-3)20-31(38)36-34-19-23-6-13-27(14-7-23)44-21-32(39)35-25-10-8-24(33)9-11-25/h4-19H,20-21H2,1-3H3,(H,35,39)(H,36,38) |
| InChIKey | OKMBYXUNPFFNHF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 135.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.69 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|