C17H17ClN4O6S — CID 3964836
N-[(2-chloro-5-nitrophenyl)methylideneamino]-2-[(4-methoxyphenyl)sulfonyl-methylamino]acetamide (PubChem CID 3964836) has the molecular formula C17H17ClN4O6S and a molecular weight of 440.87 g/mol. Its IUPAC name is N-[(2-chloro-5-nitrophenyl)methylideneamino]-2-[(4-methoxyphenyl)sulfonyl-methylamino]acetamide.
| Compound Name | N-[(2-chloro-5-nitrophenyl)methylideneamino]-2-[(4-methoxyphenyl)sulfonyl-methylamino]acetamide |
|---|---|
| PubChem CID | 3964836 |
| Molecular Formula | C17H17ClN4O6S |
| Molecular Weight | 440.87 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | N-[(2-chloro-5-nitrophenyl)methylideneamino]-2-[(4-methoxyphenyl)sulfonyl-methylamino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)CC(=O)NN=Cc2cc([N+](=O)[O-])ccc2Cl)cc1 |
| InChI | InChI=1S/C17H17ClN4O6S/c1-21(29(26,27)15-6-4-14(28-2)5-7-15)11-17(23)20-19-10-12-9-13(22(24)25)3-8-16(12)18/h3-10H,11H2,1-2H3,(H,20,23) |
| InChIKey | ZNKMTVRSAVGBJR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.87 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|