C23H21Cl2N3O4S — CID 28589358
N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-(2-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 28589358) has the molecular formula C23H21Cl2N3O4S and a molecular weight of 506.41 g/mol. Its IUPAC name is N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-(2-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-(2-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 28589358 |
| Molecular Formula | C23H21Cl2N3O4S |
| Molecular Weight | 506.41 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-(2-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | COc1ccccc1N(CC(=O)N/N=C\c1ccc(Cl)cc1Cl)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H21Cl2N3O4S/c1-16-7-11-19(12-8-16)33(30,31)28(21-5-3-4-6-22(21)32-2)15-23(29)27-26-14-17-9-10-18(24)13-20(17)25/h3-14H,15H2,1-2H3,(H,27,29)/b26-14- |
| InChIKey | XDYUKDQZBZWDRA-WGARJPEWSA-N |
| XLogP | 4.66 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.41 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|