C19H20ClN3O6S — CID 4787291
2-chloro-N-(2-methoxyphenyl)-5-nitro-N-(2-oxo-2-pyrrolidin-1-ylethyl)benzenesulfonamide (PubChem CID 4787291) has the molecular formula C19H20ClN3O6S and a molecular weight of 453.90 g/mol. Its IUPAC name is 2-chloro-N-(2-methoxyphenyl)-5-nitro-N-(2-oxo-2-pyrrolidin-1-ylethyl)benzenesulfonamide.
| Compound Name | 2-chloro-N-(2-methoxyphenyl)-5-nitro-N-(2-oxo-2-pyrrolidin-1-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 4787291 |
| Molecular Formula | C19H20ClN3O6S |
| Molecular Weight | 453.90 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 2-chloro-N-(2-methoxyphenyl)-5-nitro-N-(2-oxo-2-pyrrolidin-1-ylethyl)benzenesulfonamide |
| SMILES | COc1ccccc1N(CC(=O)N1CCCC1)S(=O)(=O)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C19H20ClN3O6S/c1-29-17-7-3-2-6-16(17)22(13-19(24)21-10-4-5-11-21)30(27,28)18-12-14(23(25)26)8-9-15(18)20/h2-3,6-9,12H,4-5,10-11,13H2,1H3 |
| InChIKey | OVDDLFBOOZNNNM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.90 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|