C21H26N4O6S — CID 55346767
2-(N-ethyl-4-nitro-2-pyrrolidin-1-ylsulfonylanilino)-N-(2-methoxyphenyl)acetamide (PubChem CID 55346767) has the molecular formula C21H26N4O6S and a molecular weight of 462.53 g/mol. Its IUPAC name is 2-(N-ethyl-4-nitro-2-pyrrolidin-1-ylsulfonylanilino)-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-(N-ethyl-4-nitro-2-pyrrolidin-1-ylsulfonylanilino)-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 55346767 |
| Molecular Formula | C21H26N4O6S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 2-(N-ethyl-4-nitro-2-pyrrolidin-1-ylsulfonylanilino)-N-(2-methoxyphenyl)acetamide |
| SMILES | CCN(CC(=O)Nc1ccccc1OC)c1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C21H26N4O6S/c1-3-23(15-21(26)22-17-8-4-5-9-19(17)31-2)18-11-10-16(25(27)28)14-20(18)32(29,30)24-12-6-7-13-24/h4-5,8-11,14H,3,6-7,12-13,15H2,1-2H3,(H,22,26) |
| InChIKey | QZYIHMVTEBHVRW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|