C14H12ClFN4O5S — CID 50894131
N-(2-chloro-5-nitrophenyl)-4-fluoro-N-(2-hydrazinyl-2-oxoethyl)benzenesulfonamide (PubChem CID 50894131) has the molecular formula C14H12ClFN4O5S and a molecular weight of 402.79 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-4-fluoro-N-(2-hydrazinyl-2-oxoethyl)benzenesulfonamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-4-fluoro-N-(2-hydrazinyl-2-oxoethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 50894131 |
| Molecular Formula | C14H12ClFN4O5S |
| Molecular Weight | 402.79 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-4-fluoro-N-(2-hydrazinyl-2-oxoethyl)benzenesulfonamide |
| SMILES | NNC(=O)CN(c1cc([N+](=O)[O-])ccc1Cl)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H12ClFN4O5S/c15-12-6-3-10(20(22)23)7-13(12)19(8-14(21)18-17)26(24,25)11-4-1-9(16)2-5-11/h1-7H,8,17H2,(H,18,21) |
| InChIKey | FQEIQVWCOCUEID-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.79 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|