C14H13F2N3O3S — CID 50890637
4-fluoro-N-(2-fluorophenyl)-N-(2-hydrazinyl-2-oxoethyl)benzenesulfonamide (PubChem CID 50890637) has the molecular formula C14H13F2N3O3S and a molecular weight of 341.34 g/mol. Its IUPAC name is 4-fluoro-N-(2-fluorophenyl)-N-(2-hydrazinyl-2-oxoethyl)benzenesulfonamide.
| Compound Name | 4-fluoro-N-(2-fluorophenyl)-N-(2-hydrazinyl-2-oxoethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 50890637 |
| Molecular Formula | C14H13F2N3O3S |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 4-fluoro-N-(2-fluorophenyl)-N-(2-hydrazinyl-2-oxoethyl)benzenesulfonamide |
| SMILES | NNC(=O)CN(c1ccccc1F)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H13F2N3O3S/c15-10-5-7-11(8-6-10)23(21,22)19(9-14(20)18-17)13-4-2-1-3-12(13)16/h1-8H,9,17H2,(H,18,20) |
| InChIKey | AFYQBNISRGDTQQ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|