C15H16FN3O3S — CID 50890034
4-fluoro-N-(2-hydrazinyl-2-oxoethyl)-N-(3-methylphenyl)benzenesulfonamide (PubChem CID 50890034) has the molecular formula C15H16FN3O3S and a molecular weight of 337.38 g/mol. Its IUPAC name is 4-fluoro-N-(2-hydrazinyl-2-oxoethyl)-N-(3-methylphenyl)benzenesulfonamide.
| Compound Name | 4-fluoro-N-(2-hydrazinyl-2-oxoethyl)-N-(3-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 50890034 |
| Molecular Formula | C15H16FN3O3S |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 4-fluoro-N-(2-hydrazinyl-2-oxoethyl)-N-(3-methylphenyl)benzenesulfonamide |
| SMILES | Cc1cccc(N(CC(=O)NN)S(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C15H16FN3O3S/c1-11-3-2-4-13(9-11)19(10-15(20)18-17)23(21,22)14-7-5-12(16)6-8-14/h2-9H,10,17H2,1H3,(H,18,20) |
| InChIKey | FLGWXNFIPOAUMJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|