C17H18FN3O4S — CID 50894740
4-fluoro-N-(2-hydrazinyl-2-oxoethyl)-N-(3-prop-2-enoxyphenyl)benzenesulfonamide (PubChem CID 50894740) has the molecular formula C17H18FN3O4S and a molecular weight of 379.41 g/mol. Its IUPAC name is 4-fluoro-N-(2-hydrazinyl-2-oxoethyl)-N-(3-prop-2-enoxyphenyl)benzenesulfonamide.
| Compound Name | 4-fluoro-N-(2-hydrazinyl-2-oxoethyl)-N-(3-prop-2-enoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 50894740 |
| Molecular Formula | C17H18FN3O4S |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 4-fluoro-N-(2-hydrazinyl-2-oxoethyl)-N-(3-prop-2-enoxyphenyl)benzenesulfonamide |
| SMILES | C=CCOc1cccc(N(CC(=O)NN)S(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H18FN3O4S/c1-2-10-25-15-5-3-4-14(11-15)21(12-17(22)20-19)26(23,24)16-8-6-13(18)7-9-16/h2-9,11H,1,10,12,19H2,(H,20,22) |
| InChIKey | AZINHMVMCPWZND-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|