C17H18FNO5S — CID 50891577
ethyl 2-(N-(4-fluorophenyl)sulfonyl-3-methoxyanilino)acetate (PubChem CID 50891577) has the molecular formula C17H18FNO5S and a molecular weight of 367.40 g/mol. Its IUPAC name is ethyl 2-(N-(4-fluorophenyl)sulfonyl-3-methoxyanilino)acetate.
| Compound Name | ethyl 2-(N-(4-fluorophenyl)sulfonyl-3-methoxyanilino)acetate |
|---|---|
| PubChem CID | 50891577 |
| Molecular Formula | C17H18FNO5S |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | ethyl 2-(N-(4-fluorophenyl)sulfonyl-3-methoxyanilino)acetate |
| SMILES | CCOC(=O)CN(c1cccc(OC)c1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H18FNO5S/c1-3-24-17(20)12-19(14-5-4-6-15(11-14)23-2)25(21,22)16-9-7-13(18)8-10-16/h4-11H,3,12H2,1-2H3 |
| InChIKey | LJZIOMDIKOINCY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |