C30H36FN3O5S — CID 132743095
N-butyl-2-[(4-fluorophenyl)methyl-[2-(3-methoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]propanamide (PubChem CID 132743095) has the molecular formula C30H36FN3O5S and a molecular weight of 569.70 g/mol. Its IUPAC name is N-butyl-2-[(4-fluorophenyl)methyl-[2-(3-methoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]propanamide.
| Compound Name | N-butyl-2-[(4-fluorophenyl)methyl-[2-(3-methoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 132743095 |
| Molecular Formula | C30H36FN3O5S |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | N-butyl-2-[(4-fluorophenyl)methyl-[2-(3-methoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(F)cc1)C(=O)CN(c1cccc(OC)c1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H36FN3O5S/c1-5-6-18-32-30(36)23(3)33(20-24-12-14-25(31)15-13-24)29(35)21-34(26-8-7-9-27(19-26)39-4)40(37,38)28-16-10-22(2)11-17-28/h7-17,19,23H,5-6,18,20-21H2,1-4H3,(H,32,36) |
| InChIKey | HYGPICYNMYOXFM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|