C35H38FN3O5S — CID 100653852
(2S)-2-[[2-[N-(benzenesulfonyl)-3-methoxyanilino]acetyl]-[(4-fluorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100653852) has the molecular formula C35H38FN3O5S and a molecular weight of 631.77 g/mol. Its IUPAC name is (2S)-2-[[2-[N-(benzenesulfonyl)-3-methoxyanilino]acetyl]-[(4-fluorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[[2-[N-(benzenesulfonyl)-3-methoxyanilino]acetyl]-[(4-fluorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100653852 |
| Molecular Formula | C35H38FN3O5S |
| Molecular Weight | 631.77 g/mol |
| Exact Mass | 631.25 |
| IUPAC Name | (2S)-2-[[2-[N-(benzenesulfonyl)-3-methoxyanilino]acetyl]-[(4-fluorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccc(F)cc1)C(=O)CN(c1cccc(OC)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C35H38FN3O5S/c1-3-4-22-37-35(41)33(23-27-12-7-5-8-13-27)38(25-28-18-20-29(36)21-19-28)34(40)26-39(30-14-11-15-31(24-30)44-2)45(42,43)32-16-9-6-10-17-32/h5-21,24,33H,3-4,22-23,25-26H2,1-2H3,(H,37,41)/t33-/m0/s1 |
| InChIKey | ALNOGRXXOYITIU-XIFFEERXSA-N |
| XLogP | 5.59 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.77 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|