C30H37N3O5S — CID 133152510
2-[benzyl-[2-(3-methoxy-N-methylsulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 133152510) has the molecular formula C30H37N3O5S and a molecular weight of 551.71 g/mol. Its IUPAC name is 2-[benzyl-[2-(3-methoxy-N-methylsulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | 2-[benzyl-[2-(3-methoxy-N-methylsulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133152510 |
| Molecular Formula | C30H37N3O5S |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | 2-[benzyl-[2-(3-methoxy-N-methylsulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccccc1)C(=O)CN(c1cccc(OC)c1)S(C)(=O)=O |
| InChI | InChI=1S/C30H37N3O5S/c1-4-5-19-31-30(35)28(20-24-13-8-6-9-14-24)32(22-25-15-10-7-11-16-25)29(34)23-33(39(3,36)37)26-17-12-18-27(21-26)38-2/h6-18,21,28H,4-5,19-20,22-23H2,1-3H3,(H,31,35) |
| InChIKey | PTKMSVINDCWILL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|