C32H39N3O6S — CID 133204706
2-[[2-(3-acetyl-N-methylsulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 133204706) has the molecular formula C32H39N3O6S and a molecular weight of 593.75 g/mol. Its IUPAC name is 2-[[2-(3-acetyl-N-methylsulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | 2-[[2-(3-acetyl-N-methylsulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133204706 |
| Molecular Formula | C32H39N3O6S |
| Molecular Weight | 593.75 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | 2-[[2-(3-acetyl-N-methylsulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1cccc(OC)c1)C(=O)CN(c1cccc(C(C)=O)c1)S(C)(=O)=O |
| InChI | InChI=1S/C32H39N3O6S/c1-5-6-18-33-32(38)30(20-25-12-8-7-9-13-25)34(22-26-14-10-17-29(19-26)41-3)31(37)23-35(42(4,39)40)28-16-11-15-27(21-28)24(2)36/h7-17,19,21,30H,5-6,18,20,22-23H2,1-4H3,(H,33,38) |
| InChIKey | HGFJHORPDBEXFQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.75 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|