C31H36BrN3O5S — CID 100668202
(2S)-2-[[2-(3-acetyl-N-methylsulfonylanilino)acetyl]-[(3-bromophenyl)methyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100668202) has the molecular formula C31H36BrN3O5S and a molecular weight of 642.62 g/mol. Its IUPAC name is (2S)-2-[[2-(3-acetyl-N-methylsulfonylanilino)acetyl]-[(3-bromophenyl)methyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[[2-(3-acetyl-N-methylsulfonylanilino)acetyl]-[(3-bromophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100668202 |
| Molecular Formula | C31H36BrN3O5S |
| Molecular Weight | 642.62 g/mol |
| Exact Mass | 641.16 |
| IUPAC Name | (2S)-2-[[2-(3-acetyl-N-methylsulfonylanilino)acetyl]-[(3-bromophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1cccc(Br)c1)C(=O)CN(c1cccc(C(C)=O)c1)S(C)(=O)=O |
| InChI | InChI=1S/C31H36BrN3O5S/c1-4-5-17-33-31(38)29(19-24-11-7-6-8-12-24)34(21-25-13-9-15-27(32)18-25)30(37)22-35(41(3,39)40)28-16-10-14-26(20-28)23(2)36/h6-16,18,20,29H,4-5,17,19,21-22H2,1-3H3,(H,33,38)/t29-/m0/s1 |
| InChIKey | OVQOUGBHXDQJIY-LJAQVGFWSA-N |
| XLogP | 4.97 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.62 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|