C31H38BrN3O4S — CID 100666736
(2S)-2-[(3-bromophenyl)methyl-[2-(2,6-dimethyl-N-methylsulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100666736) has the molecular formula C31H38BrN3O4S and a molecular weight of 628.63 g/mol. Its IUPAC name is (2S)-2-[(3-bromophenyl)methyl-[2-(2,6-dimethyl-N-methylsulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[(3-bromophenyl)methyl-[2-(2,6-dimethyl-N-methylsulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100666736 |
| Molecular Formula | C31H38BrN3O4S |
| Molecular Weight | 628.63 g/mol |
| Exact Mass | 627.18 |
| IUPAC Name | (2S)-2-[(3-bromophenyl)methyl-[2-(2,6-dimethyl-N-methylsulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1cccc(Br)c1)C(=O)CN(c1c(C)cccc1C)S(C)(=O)=O |
| InChI | InChI=1S/C31H38BrN3O4S/c1-5-6-18-33-31(37)28(20-25-14-8-7-9-15-25)34(21-26-16-11-17-27(32)19-26)29(36)22-35(40(4,38)39)30-23(2)12-10-13-24(30)3/h7-17,19,28H,5-6,18,20-22H2,1-4H3,(H,33,37)/t28-/m0/s1 |
| InChIKey | NBYUMIJULUTTCS-NDEPHWFRSA-N |
| XLogP | 5.39 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.63 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|