C17H16FNO6S — CID 100503153
ethyl 2-[1,3-benzodioxol-5-yl-(4-fluorophenyl)sulfonylamino]acetate (PubChem CID 100503153) has the molecular formula C17H16FNO6S and a molecular weight of 381.38 g/mol. Its IUPAC name is ethyl 2-[1,3-benzodioxol-5-yl-(4-fluorophenyl)sulfonylamino]acetate.
| Compound Name | ethyl 2-[1,3-benzodioxol-5-yl-(4-fluorophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 100503153 |
| Molecular Formula | C17H16FNO6S |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | ethyl 2-[1,3-benzodioxol-5-yl-(4-fluorophenyl)sulfonylamino]acetate |
| SMILES | CCOC(=O)CN(c1ccc2c(c1)OCO2)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H16FNO6S/c1-2-23-17(20)10-19(13-5-8-15-16(9-13)25-11-24-15)26(21,22)14-6-3-12(18)4-7-14/h3-9H,2,10-11H2,1H3 |
| InChIKey | CSWBBCOBHUJBOI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |