C16H15ClFNO4S — CID 52689634
ethyl 2-(N-(3-chlorophenyl)sulfonyl-4-fluoroanilino)acetate (PubChem CID 52689634) has the molecular formula C16H15ClFNO4S and a molecular weight of 371.82 g/mol. Its IUPAC name is ethyl 2-(N-(3-chlorophenyl)sulfonyl-4-fluoroanilino)acetate.
| Compound Name | ethyl 2-(N-(3-chlorophenyl)sulfonyl-4-fluoroanilino)acetate |
|---|---|
| PubChem CID | 52689634 |
| Molecular Formula | C16H15ClFNO4S |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | ethyl 2-(N-(3-chlorophenyl)sulfonyl-4-fluoroanilino)acetate |
| SMILES | CCOC(=O)CN(c1ccc(F)cc1)S(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H15ClFNO4S/c1-2-23-16(20)11-19(14-8-6-13(18)7-9-14)24(21,22)15-5-3-4-12(17)10-15/h3-10H,2,11H2,1H3 |
| InChIKey | OERPJPPAHMYYDQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |