C13H16ClNO4S — CID 78977818
ethyl 2-[(3-chlorophenyl)sulfonyl-prop-2-enylamino]acetate (PubChem CID 78977818) has the molecular formula C13H16ClNO4S and a molecular weight of 317.79 g/mol. Its IUPAC name is ethyl 2-[(3-chlorophenyl)sulfonyl-prop-2-enylamino]acetate.
| Compound Name | ethyl 2-[(3-chlorophenyl)sulfonyl-prop-2-enylamino]acetate |
|---|---|
| PubChem CID | 78977818 |
| Molecular Formula | C13H16ClNO4S |
| Molecular Weight | 317.79 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | ethyl 2-[(3-chlorophenyl)sulfonyl-prop-2-enylamino]acetate |
| SMILES | C=CCN(CC(=O)OCC)S(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H16ClNO4S/c1-3-8-15(10-13(16)19-4-2)20(17,18)12-7-5-6-11(14)9-12/h3,5-7,9H,1,4,8,10H2,2H3 |
| InChIKey | QTGFYRLCTSTFMM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.79 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|