C11H15N3O6S — CID 115538991
ethyl 2-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl-prop-2-enylamino]acetate (PubChem CID 115538991) has the molecular formula C11H15N3O6S and a molecular weight of 317.32 g/mol. Its IUPAC name is ethyl 2-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl-prop-2-enylamino]acetate.
| Compound Name | ethyl 2-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl-prop-2-enylamino]acetate |
|---|---|
| PubChem CID | 115538991 |
| Molecular Formula | C11H15N3O6S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | ethyl 2-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl-prop-2-enylamino]acetate |
| SMILES | C=CCN(CC(=O)OCC)S(=O)(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H15N3O6S/c1-3-5-14(7-9(15)20-4-2)21(18,19)8-6-12-11(17)13-10(8)16/h3,6H,1,4-5,7H2,2H3,(H2,12,13,16,17) |
| InChIKey | NVGWFBJJYICXLI-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 129.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|