C14H16BN4O8 — CID 158810794
CID 158810794 (PubChem CID 158810794) has the molecular formula C14H16BN4O8 and a molecular weight of 379.11 g/mol.
| Compound Name | CID 158810794 |
|---|---|
| PubChem CID | 158810794 |
| Molecular Formula | C14H16BN4O8 |
| Molecular Weight | 379.11 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | — |
| SMILES | CCOC(=O)Cc1c[nH]c(=O)[nH]c1=O.O=C(O)Cc1c[nH]c(=O)[nH]c1=O.[B] |
| InChI | InChI=1S/C8H10N2O4.C6H6N2O4.B/c1-2-14-6(11)3-5-4-9-8(13)10-7(5)12;9-4(10)1-3-2-7-6(12)8-5(3)11;/h4H,2-3H2,1H3,(H2,9,10,12,13);2H,1H2,(H,9,10)(H2,7,8,11,12); |
| InChIKey | BKYADUWNMGYICL-UHFFFAOYSA-N |
| XLogP | -2.52 |
| TPSA | 195.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.11 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|