C9H15N2O5P — CID 10515594
5-(diethoxyphosphorylmethyl)-1H-pyrimidine-2,4-dione (PubChem CID 10515594) has the molecular formula C9H15N2O5P and a molecular weight of 262.20 g/mol. Its IUPAC name is 5-(diethoxyphosphorylmethyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(diethoxyphosphorylmethyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10515594 |
| Molecular Formula | C9H15N2O5P |
| Molecular Weight | 262.20 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 5-(diethoxyphosphorylmethyl)-1H-pyrimidine-2,4-dione |
| SMILES | CCOP(=O)(Cc1c[nH]c(=O)[nH]c1=O)OCC |
| InChI | InChI=1S/C9H15N2O5P/c1-3-15-17(14,16-4-2)6-7-5-10-9(13)11-8(7)12/h5H,3-4,6H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | AZZPOSXNXYUQKP-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 101.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.20 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|