C10H14N4O7 — CID 70550921
bis(5-(hydroxymethyl)-1H-pyrimidine-2,4-dione);hydrate (PubChem CID 70550921) has the molecular formula C10H14N4O7 and a molecular weight of 302.24 g/mol. Its IUPAC name is bis(5-(hydroxymethyl)-1H-pyrimidine-2,4-dione);hydrate.
| Compound Name | bis(5-(hydroxymethyl)-1H-pyrimidine-2,4-dione);hydrate |
|---|---|
| PubChem CID | 70550921 |
| Molecular Formula | C10H14N4O7 |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | bis(5-(hydroxymethyl)-1H-pyrimidine-2,4-dione);hydrate |
| SMILES | O.O=c1[nH]cc(CO)c(=O)[nH]1.O=c1[nH]cc(CO)c(=O)[nH]1 |
| InChI | InChI=1S/2C5H6N2O3.H2O/c2*8-2-3-1-6-5(10)7-4(3)9;/h2*1,8H,2H2,(H2,6,7,9,10);1H2 |
| InChIKey | PKRNJWWIXADPAH-UHFFFAOYSA-N |
| XLogP | -3.71 |
| TPSA | 203.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | -3.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |