C18H26N2O6P2 — CID 135072070
4,5-bis(diethoxyphosphorylmethyl)benzene-1,2-dicarbonitrile (PubChem CID 135072070) has the molecular formula C18H26N2O6P2 and a molecular weight of 428.36 g/mol. Its IUPAC name is 4,5-bis(diethoxyphosphorylmethyl)benzene-1,2-dicarbonitrile.
| Compound Name | 4,5-bis(diethoxyphosphorylmethyl)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 135072070 |
| Molecular Formula | C18H26N2O6P2 |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 4,5-bis(diethoxyphosphorylmethyl)benzene-1,2-dicarbonitrile |
| SMILES | CCOP(=O)(Cc1cc(C#N)c(C#N)cc1CP(=O)(OCC)OCC)OCC |
| InChI | InChI=1S/C18H26N2O6P2/c1-5-23-27(21,24-6-2)13-17-9-15(11-19)16(12-20)10-18(17)14-28(22,25-7-3)26-8-4/h9-10H,5-8,13-14H2,1-4H3 |
| InChIKey | FEPJFKCFWZMRML-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 118.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|