C10H15O6P — CID 18414987
3-(diethoxyphosphorylmethyl)furan-2-carboxylic acid (PubChem CID 18414987) has the molecular formula C10H15O6P and a molecular weight of 262.20 g/mol. Its IUPAC name is 3-(diethoxyphosphorylmethyl)furan-2-carboxylic acid.
| Compound Name | 3-(diethoxyphosphorylmethyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 18414987 |
| Molecular Formula | C10H15O6P |
| Molecular Weight | 262.20 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 3-(diethoxyphosphorylmethyl)furan-2-carboxylic acid |
| SMILES | CCOP(=O)(Cc1ccoc1C(=O)O)OCC |
| InChI | InChI=1S/C10H15O6P/c1-3-15-17(13,16-4-2)7-8-5-6-14-9(8)10(11)12/h5-6H,3-4,7H2,1-2H3,(H,11,12) |
| InChIKey | AFKUVYBEVNIMRK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.20 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|