C9H12O5S — CID 60872303
3-(propan-2-ylsulfonylmethyl)furan-2-carboxylic acid (PubChem CID 60872303) has the molecular formula C9H12O5S and a molecular weight of 232.26 g/mol. Its IUPAC name is 3-(propan-2-ylsulfonylmethyl)furan-2-carboxylic acid.
| Compound Name | 3-(propan-2-ylsulfonylmethyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 60872303 |
| Molecular Formula | C9H12O5S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 3-(propan-2-ylsulfonylmethyl)furan-2-carboxylic acid |
| SMILES | CC(C)S(=O)(=O)Cc1ccoc1C(=O)O |
| InChI | InChI=1S/C9H12O5S/c1-6(2)15(12,13)5-7-3-4-14-8(7)9(10)11/h3-4,6H,5H2,1-2H3,(H,10,11) |
| InChIKey | RSJRYCDZBLAJOD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |