C14H14O5S — CID 43153115
3-[(3,4-dimethylphenyl)sulfonylmethyl]furan-2-carboxylic acid (PubChem CID 43153115) has the molecular formula C14H14O5S and a molecular weight of 294.33 g/mol. Its IUPAC name is 3-[(3,4-dimethylphenyl)sulfonylmethyl]furan-2-carboxylic acid.
| Compound Name | 3-[(3,4-dimethylphenyl)sulfonylmethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 43153115 |
| Molecular Formula | C14H14O5S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 3-[(3,4-dimethylphenyl)sulfonylmethyl]furan-2-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)Cc2ccoc2C(=O)O)cc1C |
| InChI | InChI=1S/C14H14O5S/c1-9-3-4-12(7-10(9)2)20(17,18)8-11-5-6-19-13(11)14(15)16/h3-7H,8H2,1-2H3,(H,15,16) |
| InChIKey | PHAHJESDIJLEGL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |