C21H21NO4S — CID 51283759
3-(benzenesulfonylmethyl)-N-methyl-N-[(2-methylphenyl)methyl]furan-2-carboxamide (PubChem CID 51283759) has the molecular formula C21H21NO4S and a molecular weight of 383.47 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-N-methyl-N-[(2-methylphenyl)methyl]furan-2-carboxamide.
| Compound Name | 3-(benzenesulfonylmethyl)-N-methyl-N-[(2-methylphenyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 51283759 |
| Molecular Formula | C21H21NO4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-N-methyl-N-[(2-methylphenyl)methyl]furan-2-carboxamide |
| SMILES | Cc1ccccc1CN(C)C(=O)c1occc1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H21NO4S/c1-16-8-6-7-9-17(16)14-22(2)21(23)20-18(12-13-26-20)15-27(24,25)19-10-4-3-5-11-19/h3-13H,14-15H2,1-2H3 |
| InChIKey | BGHQNNCNKFXYBW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |