C20H18ClNO4S — CID 46664583
3-(benzenesulfonylmethyl)-N-[(3-chlorophenyl)methyl]-N-methylfuran-2-carboxamide (PubChem CID 46664583) has the molecular formula C20H18ClNO4S and a molecular weight of 403.89 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-N-[(3-chlorophenyl)methyl]-N-methylfuran-2-carboxamide.
| Compound Name | 3-(benzenesulfonylmethyl)-N-[(3-chlorophenyl)methyl]-N-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 46664583 |
| Molecular Formula | C20H18ClNO4S |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-N-[(3-chlorophenyl)methyl]-N-methylfuran-2-carboxamide |
| SMILES | CN(Cc1cccc(Cl)c1)C(=O)c1occc1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H18ClNO4S/c1-22(13-15-6-5-7-17(21)12-15)20(23)19-16(10-11-26-19)14-27(24,25)18-8-3-2-4-9-18/h2-12H,13-14H2,1H3 |
| InChIKey | RXUXNIWZPQCEPY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |