C22H27NO6S — CID 55466315
[1-(cyclohexylmethylamino)-1-oxopropan-2-yl] 3-(benzenesulfonylmethyl)furan-2-carboxylate (PubChem CID 55466315) has the molecular formula C22H27NO6S and a molecular weight of 433.53 g/mol. Its IUPAC name is [1-(cyclohexylmethylamino)-1-oxopropan-2-yl] 3-(benzenesulfonylmethyl)furan-2-carboxylate.
| Compound Name | [1-(cyclohexylmethylamino)-1-oxopropan-2-yl] 3-(benzenesulfonylmethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 55466315 |
| Molecular Formula | C22H27NO6S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | [1-(cyclohexylmethylamino)-1-oxopropan-2-yl] 3-(benzenesulfonylmethyl)furan-2-carboxylate |
| SMILES | CC(OC(=O)c1occc1CS(=O)(=O)c1ccccc1)C(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C22H27NO6S/c1-16(21(24)23-14-17-8-4-2-5-9-17)29-22(25)20-18(12-13-28-20)15-30(26,27)19-10-6-3-7-11-19/h3,6-7,10-13,16-17H,2,4-5,8-9,14-15H2,1H3,(H,23,24) |
| InChIKey | SIDUIVMIWDQCCV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |