C23H23NO6S — CID 55467064
[2-oxo-2-(N-propan-2-ylanilino)ethyl] 3-(benzenesulfonylmethyl)furan-2-carboxylate (PubChem CID 55467064) has the molecular formula C23H23NO6S and a molecular weight of 441.51 g/mol. Its IUPAC name is [2-oxo-2-(N-propan-2-ylanilino)ethyl] 3-(benzenesulfonylmethyl)furan-2-carboxylate.
| Compound Name | [2-oxo-2-(N-propan-2-ylanilino)ethyl] 3-(benzenesulfonylmethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 55467064 |
| Molecular Formula | C23H23NO6S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | [2-oxo-2-(N-propan-2-ylanilino)ethyl] 3-(benzenesulfonylmethyl)furan-2-carboxylate |
| SMILES | CC(C)N(C(=O)COC(=O)c1occc1CS(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H23NO6S/c1-17(2)24(19-9-5-3-6-10-19)21(25)15-30-23(26)22-18(13-14-29-22)16-31(27,28)20-11-7-4-8-12-20/h3-14,17H,15-16H2,1-2H3 |
| InChIKey | DNRGWSNEBDBVKB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |