C21H17FO7S — CID 30908299
[2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] 3-(benzenesulfonylmethyl)furan-2-carboxylate (PubChem CID 30908299) has the molecular formula C21H17FO7S and a molecular weight of 432.43 g/mol. Its IUPAC name is [2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] 3-(benzenesulfonylmethyl)furan-2-carboxylate.
| Compound Name | [2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] 3-(benzenesulfonylmethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 30908299 |
| Molecular Formula | C21H17FO7S |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | [2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] 3-(benzenesulfonylmethyl)furan-2-carboxylate |
| SMILES | COc1ccc(F)cc1C(=O)COC(=O)c1occc1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H17FO7S/c1-27-19-8-7-15(22)11-17(19)18(23)12-29-21(24)20-14(9-10-28-20)13-30(25,26)16-5-3-2-4-6-16/h2-11H,12-13H2,1H3 |
| InChIKey | NSWZGJWFLBPTRW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 99.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |