C21H19NO7S — CID 75431889
4-[[[3-(benzenesulfonylmethyl)furan-2-carbonyl]amino]methyl]-2-methoxybenzoic acid (PubChem CID 75431889) has the molecular formula C21H19NO7S and a molecular weight of 429.45 g/mol. Its IUPAC name is 4-[[[3-(benzenesulfonylmethyl)furan-2-carbonyl]amino]methyl]-2-methoxybenzoic acid.
| Compound Name | 4-[[[3-(benzenesulfonylmethyl)furan-2-carbonyl]amino]methyl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 75431889 |
| Molecular Formula | C21H19NO7S |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 4-[[[3-(benzenesulfonylmethyl)furan-2-carbonyl]amino]methyl]-2-methoxybenzoic acid |
| SMILES | COc1cc(CNC(=O)c2occc2CS(=O)(=O)c2ccccc2)ccc1C(=O)O |
| InChI | InChI=1S/C21H19NO7S/c1-28-18-11-14(7-8-17(18)21(24)25)12-22-20(23)19-15(9-10-29-19)13-30(26,27)16-5-3-2-4-6-16/h2-11H,12-13H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | LSFNJVMCNMCXJX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |