C14H14O5S — CID 35726189
ethyl 3-(benzenesulfonylmethyl)furan-2-carboxylate (PubChem CID 35726189) has the molecular formula C14H14O5S and a molecular weight of 294.33 g/mol. Its IUPAC name is ethyl 3-(benzenesulfonylmethyl)furan-2-carboxylate.
| Compound Name | ethyl 3-(benzenesulfonylmethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 35726189 |
| Molecular Formula | C14H14O5S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | ethyl 3-(benzenesulfonylmethyl)furan-2-carboxylate |
| SMILES | CCOC(=O)c1occc1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H14O5S/c1-2-18-14(15)13-11(8-9-19-13)10-20(16,17)12-6-4-3-5-7-12/h3-9H,2,10H2,1H3 |
| InChIKey | NFPVZUORQFZYGJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |